C29H32O6 — CID 97302296
(2R,4aR,6R,7R,8R,8aR)-2-(4-methoxyphenyl)-6-methyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 97302296) has the molecular formula C29H32O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is (2R,4aR,6R,7R,8R,8aR)-2-(4-methoxyphenyl)-6-methyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6R,7R,8R,8aR)-2-(4-methoxyphenyl)-6-methyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 97302296 |
| Molecular Formula | C29H32O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | (2R,4aR,6R,7R,8R,8aR)-2-(4-methoxyphenyl)-6-methyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | COc1ccc([C@@H]2OC[C@H]3O[C@H](C)[C@@H](OCc4ccccc4)[C@@H](OCc4ccccc4)[C@@H]3O2)cc1 |
| InChI | InChI=1S/C29H32O6/c1-20-26(31-17-21-9-5-3-6-10-21)28(32-18-22-11-7-4-8-12-22)27-25(34-20)19-33-29(35-27)23-13-15-24(30-2)16-14-23/h3-16,20,25-29H,17-19H2,1-2H3/t20-,25-,26-,27-,28-,29-/m1/s1 |
| InChIKey | AJZFGMCCOVKCNF-NRJOHNGXSA-N |
| XLogP | 5.07 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |