C30H32O6S — CID 10815834
(2R,4aR,6S,7R,8S,8aR)-2-(4-methoxyphenyl)-8-phenylmethoxy-6-phenylsulfanyl-7-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 10815834) has the molecular formula C30H32O6S and a molecular weight of 520.65 g/mol. Its IUPAC name is (2R,4aR,6S,7R,8S,8aR)-2-(4-methoxyphenyl)-8-phenylmethoxy-6-phenylsulfanyl-7-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6S,7R,8S,8aR)-2-(4-methoxyphenyl)-8-phenylmethoxy-6-phenylsulfanyl-7-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 10815834 |
| Molecular Formula | C30H32O6S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | (2R,4aR,6S,7R,8S,8aR)-2-(4-methoxyphenyl)-8-phenylmethoxy-6-phenylsulfanyl-7-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | C=CCO[C@@H]1[C@@H](OCc2ccccc2)[C@@H]2O[C@H](c3ccc(OC)cc3)OC[C@H]2O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C30H32O6S/c1-3-18-32-28-27(33-19-21-10-6-4-7-11-21)26-25(35-30(28)37-24-12-8-5-9-13-24)20-34-29(36-26)22-14-16-23(31-2)17-15-22/h3-17,25-30H,1,18-20H2,2H3/t25-,26-,27+,28-,29-,30+/m1/s1 |
| InChIKey | FOHFFSSMMZLZGZ-APTUCROKSA-N |
| XLogP | 5.78 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|