C27H28O4S2 — CID 102161533
(4aR,6R,7R,8S,8aR)-7-methylsulfanyl-2-phenyl-8-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 102161533) has the molecular formula C27H28O4S2 and a molecular weight of 480.65 g/mol. Its IUPAC name is (4aR,6R,7R,8S,8aR)-7-methylsulfanyl-2-phenyl-8-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6R,7R,8S,8aR)-7-methylsulfanyl-2-phenyl-8-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 102161533 |
| Molecular Formula | C27H28O4S2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | (4aR,6R,7R,8S,8aR)-7-methylsulfanyl-2-phenyl-8-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CS[C@@H]1[C@@H](OCc2ccccc2)[C@@H]2OC(c3ccccc3)OC[C@H]2O[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C27H28O4S2/c1-32-25-24(28-17-19-11-5-2-6-12-19)23-22(30-27(25)33-21-15-9-4-10-16-21)18-29-26(31-23)20-13-7-3-8-14-20/h2-16,22-27H,17-18H2,1H3/t22-,23-,24+,25-,26?,27-/m1/s1 |
| InChIKey | WFCTXLPTKLAUSN-SXNDZAMQSA-N |
| XLogP | 5.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |