C34H29NO6S — CID 11399062
2-[(2R,4aR,6S,7R,8R,8aS)-2-phenyl-8-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]isoindole-1,3-dione (PubChem CID 11399062) has the molecular formula C34H29NO6S and a molecular weight of 579.67 g/mol. Its IUPAC name is 2-[(2R,4aR,6S,7R,8R,8aS)-2-phenyl-8-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,4aR,6S,7R,8R,8aS)-2-phenyl-8-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11399062 |
| Molecular Formula | C34H29NO6S |
| Molecular Weight | 579.67 g/mol |
| Exact Mass | 579.17 |
| IUPAC Name | 2-[(2R,4aR,6S,7R,8R,8aS)-2-phenyl-8-phenylmethoxy-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@@H]1[C@@H](OCc2ccccc2)[C@@H]2O[C@H](c3ccccc3)OC[C@H]2O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C34H29NO6S/c36-31-25-18-10-11-19-26(25)32(37)35(31)28-30(38-20-22-12-4-1-5-13-22)29-27(40-34(28)42-24-16-8-3-9-17-24)21-39-33(41-29)23-14-6-2-7-15-23/h1-19,27-30,33-34H,20-21H2/t27-,28-,29-,30-,33-,34+/m1/s1 |
| InChIKey | FISDDJLKTIGINZ-IGXPJUEDSA-N |
| XLogP | 5.87 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|