C32H30O4S2 — CID 102161523
(4aR,6S,7S,8S,8aR)-2-phenyl-8-phenylmethoxy-6,7-bis(phenylsulfanyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 102161523) has the molecular formula C32H30O4S2 and a molecular weight of 542.72 g/mol. Its IUPAC name is (4aR,6S,7S,8S,8aR)-2-phenyl-8-phenylmethoxy-6,7-bis(phenylsulfanyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6S,7S,8S,8aR)-2-phenyl-8-phenylmethoxy-6,7-bis(phenylsulfanyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 102161523 |
| Molecular Formula | C32H30O4S2 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | (4aR,6S,7S,8S,8aR)-2-phenyl-8-phenylmethoxy-6,7-bis(phenylsulfanyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | c1ccc(CO[C@H]2[C@@H]3OC(c4ccccc4)OC[C@H]3O[C@@H](Sc3ccccc3)[C@H]2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C32H30O4S2/c1-5-13-23(14-6-1)21-33-29-28-27(22-34-31(36-28)24-15-7-2-8-16-24)35-32(38-26-19-11-4-12-20-26)30(29)37-25-17-9-3-10-18-25/h1-20,27-32H,21-22H2/t27-,28-,29+,30+,31?,32+/m1/s1 |
| InChIKey | VLWPXCQXNBYVTG-GAAADJIESA-N |
| XLogP | 7.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |