C37H40O8S — CID 67229561
(4aR,6S,7R,8S,8aS)-2-(4-methoxyphenyl)-7,8-bis[(4-methoxyphenyl)methoxy]-6-(4-methylphenyl)sulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 67229561) has the molecular formula C37H40O8S and a molecular weight of 644.79 g/mol. Its IUPAC name is (4aR,6S,7R,8S,8aS)-2-(4-methoxyphenyl)-7,8-bis[(4-methoxyphenyl)methoxy]-6-(4-methylphenyl)sulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6S,7R,8S,8aS)-2-(4-methoxyphenyl)-7,8-bis[(4-methoxyphenyl)methoxy]-6-(4-methylphenyl)sulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 67229561 |
| Molecular Formula | C37H40O8S |
| Molecular Weight | 644.79 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | (4aR,6S,7R,8S,8aS)-2-(4-methoxyphenyl)-7,8-bis[(4-methoxyphenyl)methoxy]-6-(4-methylphenyl)sulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | COc1ccc(CO[C@H]2[C@H]3OC(c4ccc(OC)cc4)OC[C@H]3O[C@@H](Sc3ccc(C)cc3)[C@@H]2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C37H40O8S/c1-24-5-19-31(20-6-24)46-37-35(42-22-26-9-15-29(39-3)16-10-26)34(41-21-25-7-13-28(38-2)14-8-25)33-32(44-37)23-43-36(45-33)27-11-17-30(40-4)18-12-27/h5-20,32-37H,21-23H2,1-4H3/t32-,33+,34+,35-,36?,37+/m1/s1 |
| InChIKey | GYMGSDHLLHHNRF-IUTSXMMASA-N |
| XLogP | 7.12 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.79 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |