C35H42O7S — CID 90111606
[(4aR,6R,7S,8S,8aR)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] octanoate (PubChem CID 90111606) has the molecular formula C35H42O7S and a molecular weight of 606.78 g/mol. Its IUPAC name is [(4aR,6R,7S,8S,8aR)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] octanoate.
| Compound Name | [(4aR,6R,7S,8S,8aR)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] octanoate |
|---|---|
| PubChem CID | 90111606 |
| Molecular Formula | C35H42O7S |
| Molecular Weight | 606.78 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | [(4aR,6R,7S,8S,8aR)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]1[C@@H](OCc2ccc(OC)cc2)[C@@H]2OC(c3ccccc3)OC[C@H]2O[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C35H42O7S/c1-3-4-5-6-13-18-30(36)41-33-32(38-23-25-19-21-27(37-2)22-20-25)31-29(40-35(33)43-28-16-11-8-12-17-28)24-39-34(42-31)26-14-9-7-10-15-26/h7-12,14-17,19-22,29,31-35H,3-6,13,18,23-24H2,1-2H3/t29-,31-,32+,33+,34?,35-/m1/s1 |
| InChIKey | WGGAYNYZCLJGRS-QCWKHDCMSA-N |
| XLogP | 7.48 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.78 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|