C32H36O7S — CID 10984609
[(2S,4aR,6S,7R,8S,8aS)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate (PubChem CID 10984609) has the molecular formula C32H36O7S and a molecular weight of 564.70 g/mol. Its IUPAC name is [(2S,4aR,6S,7R,8S,8aS)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,4aR,6S,7R,8S,8aS)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10984609 |
| Molecular Formula | C32H36O7S |
| Molecular Weight | 564.70 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | [(2S,4aR,6S,7R,8S,8aS)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate |
| SMILES | COc1ccc(CO[C@H]2[C@H]3O[C@@H](c4ccccc4)OC[C@H]3O[C@@H](Sc3ccccc3)[C@@H]2OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H36O7S/c1-32(2,3)31(33)39-28-27(35-19-21-15-17-23(34-4)18-16-21)26-25(37-30(28)40-24-13-9-6-10-14-24)20-36-29(38-26)22-11-7-5-8-12-22/h5-18,25-30H,19-20H2,1-4H3/t25-,26+,27+,28-,29+,30+/m1/s1 |
| InChIKey | NMUCADLAAMNGAW-YUCFEETJSA-N |
| XLogP | 6.17 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.70 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |