C24H28O6S — CID 102438610
[(4aR,6S,7R,8R,8aS)-7-hydroxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2-dimethylpropanoate (PubChem CID 102438610) has the molecular formula C24H28O6S and a molecular weight of 444.55 g/mol. Its IUPAC name is [(4aR,6S,7R,8R,8aS)-7-hydroxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2-dimethylpropanoate.
| Compound Name | [(4aR,6S,7R,8R,8aS)-7-hydroxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102438610 |
| Molecular Formula | C24H28O6S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | [(4aR,6S,7R,8R,8aS)-7-hydroxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@@H]1[C@@H](O)[C@H](Sc2ccccc2)O[C@@H]2COC(c3ccccc3)O[C@H]12 |
| InChI | InChI=1S/C24H28O6S/c1-24(2,3)23(26)30-20-18(25)22(31-16-12-8-5-9-13-16)28-17-14-27-21(29-19(17)20)15-10-6-4-7-11-15/h4-13,17-22,25H,14H2,1-3H3/t17-,18-,19+,20-,21?,22+/m1/s1 |
| InChIKey | ISGLJMRINGGRQI-PRYCNDIFSA-N |
| XLogP | 3.94 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |