C17H22O6S — CID 11302672
[(2S,4aR,6S,7R,8R,8aS)-6-ethylsulfanyl-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 11302672) has the molecular formula C17H22O6S and a molecular weight of 354.42 g/mol. Its IUPAC name is [(2S,4aR,6S,7R,8R,8aS)-6-ethylsulfanyl-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(2S,4aR,6S,7R,8R,8aS)-6-ethylsulfanyl-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 11302672 |
| Molecular Formula | C17H22O6S |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [(2S,4aR,6S,7R,8R,8aS)-6-ethylsulfanyl-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CCS[C@@H]1O[C@@H]2CO[C@H](c3ccccc3)O[C@@H]2[C@H](OC(C)=O)[C@H]1O |
| InChI | InChI=1S/C17H22O6S/c1-3-24-17-13(19)15(21-10(2)18)14-12(22-17)9-20-16(23-14)11-7-5-4-6-8-11/h4-8,12-17,19H,3,9H2,1-2H3/t12-,13-,14+,15-,16+,17+/m1/s1 |
| InChIKey | KIPIBHHYJWCRGL-JHMPBIJASA-N |
| XLogP | 1.87 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |