C16H20O6S — CID 100924061
[(4aR,6S,7R,8R,8aR)-6-ethylsulfanyl-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] formate (PubChem CID 100924061) has the molecular formula C16H20O6S and a molecular weight of 340.40 g/mol. Its IUPAC name is [(4aR,6S,7R,8R,8aR)-6-ethylsulfanyl-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] formate.
| Compound Name | [(4aR,6S,7R,8R,8aR)-6-ethylsulfanyl-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] formate |
|---|---|
| PubChem CID | 100924061 |
| Molecular Formula | C16H20O6S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | [(4aR,6S,7R,8R,8aR)-6-ethylsulfanyl-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] formate |
| SMILES | CCS[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](OC=O)[C@H]1O |
| InChI | InChI=1S/C16H20O6S/c1-2-23-16-12(18)14(20-9-17)13-11(21-16)8-19-15(22-13)10-6-4-3-5-7-10/h3-7,9,11-16,18H,2,8H2,1H3/t11-,12-,13-,14-,15?,16+/m1/s1 |
| InChIKey | GRJMRMVIHDFGRK-ULFACSLRSA-N |
| XLogP | 1.48 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|