C23H32O8S — CID 91266257
[(6S,8S,8aS)-6-ethylsulfanyl-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 4-acetyloxy-2,2-dimethylbutanoate (PubChem CID 91266257) has the molecular formula C23H32O8S and a molecular weight of 468.57 g/mol. Its IUPAC name is [(6S,8S,8aS)-6-ethylsulfanyl-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 4-acetyloxy-2,2-dimethylbutanoate.
| Compound Name | [(6S,8S,8aS)-6-ethylsulfanyl-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 4-acetyloxy-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91266257 |
| Molecular Formula | C23H32O8S |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | [(6S,8S,8aS)-6-ethylsulfanyl-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 4-acetyloxy-2,2-dimethylbutanoate |
| SMILES | CCS[C@@H]1OC2COC(c3ccccc3)O[C@H]2[C@H](O)C1OC(=O)C(C)(C)CCOC(C)=O |
| InChI | InChI=1S/C23H32O8S/c1-5-32-21-19(31-22(26)23(3,4)11-12-27-14(2)24)17(25)18-16(29-21)13-28-20(30-18)15-9-7-6-8-10-15/h6-10,16-21,25H,5,11-13H2,1-4H3/t16?,17-,18+,19?,20?,21-/m0/s1 |
| InChIKey | JCQJPDMWYQYQQE-WOXZHTIQSA-N |
| XLogP | 2.83 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |