C29H44O11S — CID 91244640
[(3S,4S,6S)-5-acetyloxy-3,4-dimethoxy-6-methyloxan-2-yl]methyl acetate;(6S,8R,8aS)-6-ethylsulfanyl-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 91244640) has the molecular formula C29H44O11S and a molecular weight of 600.73 g/mol. Its IUPAC name is [(3S,4S,6S)-5-acetyloxy-3,4-dimethoxy-6-methyloxan-2-yl]methyl acetate;(6S,8R,8aS)-6-ethylsulfanyl-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | [(3S,4S,6S)-5-acetyloxy-3,4-dimethoxy-6-methyloxan-2-yl]methyl acetate;(6S,8R,8aS)-6-ethylsulfanyl-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 91244640 |
| Molecular Formula | C29H44O11S |
| Molecular Weight | 600.73 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | [(3S,4S,6S)-5-acetyloxy-3,4-dimethoxy-6-methyloxan-2-yl]methyl acetate;(6S,8R,8aS)-6-ethylsulfanyl-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CCS[C@@H]1OC2COC(c3ccccc3)O[C@H]2[C@H](O)C1C.CO[C@@H]1C(OC(C)=O)[C@H](C)OC(COC(C)=O)[C@@H]1OC |
| InChI | InChI=1S/C16H22O4S.C13H22O7/c1-3-21-16-10(2)13(17)14-12(19-16)9-18-15(20-14)11-7-5-4-6-8-11;1-7-11(20-9(3)15)13(17-5)12(16-4)10(19-7)6-18-8(2)14/h4-8,10,12-17H,3,9H2,1-2H3;7,10-13H,6H2,1-5H3/t10?,12?,13-,14-,15?,16+;7-,10?,11?,12-,13+/m10/s1 |
| InChIKey | MSJNDVHLSNEHHI-VDMHCZTMSA-N |
| XLogP | 2.87 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.73 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |