C16H22O4S — CID 58919175
(6S,8R,8aR)-6-ethylsulfanyl-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 58919175) has the molecular formula C16H22O4S and a molecular weight of 310.42 g/mol. Its IUPAC name is (6S,8R,8aR)-6-ethylsulfanyl-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (6S,8R,8aR)-6-ethylsulfanyl-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 58919175 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (6S,8R,8aR)-6-ethylsulfanyl-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CCS[C@@H]1OC2COC(c3ccccc3)O[C@@H]2[C@H](O)C1C |
| InChI | InChI=1S/C16H22O4S/c1-3-21-16-10(2)13(17)14-12(19-16)9-18-15(20-14)11-7-5-4-6-8-11/h4-8,10,12-17H,3,9H2,1-2H3/t10?,12?,13-,14+,15?,16+/m1/s1 |
| InChIKey | COHCDDOLUNTVDH-JGDSVWEKSA-N |
| XLogP | 2.58 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |