C22H26O5S — CID 72975874
6-ethylsulfanyl-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 72975874) has the molecular formula C22H26O5S and a molecular weight of 402.51 g/mol. Its IUPAC name is 6-ethylsulfanyl-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | 6-ethylsulfanyl-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 72975874 |
| Molecular Formula | C22H26O5S |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 6-ethylsulfanyl-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CCSC1OC2COC(c3ccccc3)OC2C(O)C1OCc1ccccc1 |
| InChI | InChI=1S/C22H26O5S/c1-2-28-22-20(24-13-15-9-5-3-6-10-15)18(23)19-17(26-22)14-25-21(27-19)16-11-7-4-8-12-16/h3-12,17-23H,2,13-14H2,1H3 |
| InChIKey | YNMGSXAJRBVXOZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |