C31H36O5S — CID 90276839
(6S,8S,8aS)-6-(5-tert-butyl-2-methylphenyl)sulfanyl-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 90276839) has the molecular formula C31H36O5S and a molecular weight of 520.69 g/mol. Its IUPAC name is (6S,8S,8aS)-6-(5-tert-butyl-2-methylphenyl)sulfanyl-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (6S,8S,8aS)-6-(5-tert-butyl-2-methylphenyl)sulfanyl-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 90276839 |
| Molecular Formula | C31H36O5S |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | (6S,8S,8aS)-6-(5-tert-butyl-2-methylphenyl)sulfanyl-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | Cc1ccc(C(C)(C)C)cc1S[C@@H]1OC2COC(c3ccccc3)O[C@H]2[C@H](O)C1OCc1ccccc1 |
| InChI | InChI=1S/C31H36O5S/c1-20-15-16-23(31(2,3)4)17-25(20)37-30-28(33-18-21-11-7-5-8-12-21)26(32)27-24(35-30)19-34-29(36-27)22-13-9-6-10-14-22/h5-17,24,26-30,32H,18-19H2,1-4H3/t24?,26-,27+,28?,29?,30-/m0/s1 |
| InChIKey | OISZLUOUFARGED-PKVNZGMVSA-N |
| XLogP | 6.17 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |