C38H40O6S — CID 118981769
[(4aR,6S,7R,8S,8aR)-6-(5-tert-butyl-2-methylphenyl)sulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 118981769) has the molecular formula C38H40O6S and a molecular weight of 624.80 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aR)-6-(5-tert-butyl-2-methylphenyl)sulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [(4aR,6S,7R,8S,8aR)-6-(5-tert-butyl-2-methylphenyl)sulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 118981769 |
| Molecular Formula | C38H40O6S |
| Molecular Weight | 624.80 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | [(4aR,6S,7R,8S,8aR)-6-(5-tert-butyl-2-methylphenyl)sulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | Cc1ccc(C(C)(C)C)cc1S[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](OCc2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C38H40O6S/c1-25-20-21-29(38(2,3)4)22-31(25)45-37-34(43-35(39)27-16-10-6-11-17-27)33(40-23-26-14-8-5-9-15-26)32-30(42-37)24-41-36(44-32)28-18-12-7-13-19-28/h5-22,30,32-34,36-37H,23-24H2,1-4H3/t30-,32-,33+,34-,36?,37+/m1/s1 |
| InChIKey | KBMMVUHNKCZDAM-QXJFOHFISA-N |
| XLogP | 8.03 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.80 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |