C27H26O7 — CID 14630272
[(4aR,6R,7R,8R,8aS)-7-hydroxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate (PubChem CID 14630272) has the molecular formula C27H26O7 and a molecular weight of 462.50 g/mol. Its IUPAC name is [(4aR,6R,7R,8R,8aS)-7-hydroxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate.
| Compound Name | [(4aR,6R,7R,8R,8aS)-7-hydroxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate |
|---|---|
| PubChem CID | 14630272 |
| Molecular Formula | C27H26O7 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | [(4aR,6R,7R,8R,8aS)-7-hydroxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate |
| SMILES | O=C(O[C@@H]1[C@@H](O)[C@H](OCc2ccccc2)O[C@@H]2COC(c3ccccc3)O[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C27H26O7/c28-22-24(33-25(29)19-12-6-2-7-13-19)23-21(17-31-26(34-23)20-14-8-3-9-15-20)32-27(22)30-16-18-10-4-1-5-11-18/h1-15,21-24,26-28H,16-17H2/t21-,22-,23+,24-,26?,27-/m1/s1 |
| InChIKey | IXJWEHRCSHBFEH-JEUMDRGYSA-N |
| XLogP | 3.63 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |