C24H26O8 — CID 5125864
(7-acetyloxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl) acetate (PubChem CID 5125864) has the molecular formula C24H26O8 and a molecular weight of 442.46 g/mol. Its IUPAC name is (7-acetyloxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl) acetate.
| Compound Name | (7-acetyloxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl) acetate |
|---|---|
| PubChem CID | 5125864 |
| Molecular Formula | C24H26O8 |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | (7-acetyloxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl) acetate |
| SMILES | CC(=O)OC1C(OCc2ccccc2)OC2COC(c3ccccc3)OC2C1OC(C)=O |
| InChI | InChI=1S/C24H26O8/c1-15(25)29-21-20-19(14-28-23(32-20)18-11-7-4-8-12-18)31-24(22(21)30-16(2)26)27-13-17-9-5-3-6-10-17/h3-12,19-24H,13-14H2,1-2H3 |
| InChIKey | RBWWJLZVOQGLQV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |