C22H26O10S2 — CID 99642580
[(2S,4aR,6R,7R,8S,8aR)-7-methylsulfonyloxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methanesulfonate (PubChem CID 99642580) has the molecular formula C22H26O10S2 and a molecular weight of 514.57 g/mol. Its IUPAC name is [(2S,4aR,6R,7R,8S,8aR)-7-methylsulfonyloxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methanesulfonate.
| Compound Name | [(2S,4aR,6R,7R,8S,8aR)-7-methylsulfonyloxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methanesulfonate |
|---|---|
| PubChem CID | 99642580 |
| Molecular Formula | C22H26O10S2 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | [(2S,4aR,6R,7R,8S,8aR)-7-methylsulfonyloxy-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1[C@@H](OS(C)(=O)=O)[C@H](OCc2ccccc2)O[C@@H]2CO[C@H](c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C22H26O10S2/c1-33(23,24)31-19-18-17(14-28-21(30-18)16-11-7-4-8-12-16)29-22(20(19)32-34(2,25)26)27-13-15-9-5-3-6-10-15/h3-12,17-22H,13-14H2,1-2H3/t17-,18-,19+,20-,21+,22-/m1/s1 |
| InChIKey | ILNRPGCZMNYOCF-OVQJPPBNSA-N |
| XLogP | 1.73 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|