C30H32O6 — CID 163337716
(4aR,6R,7R,8S,8aR)-2-phenyl-6,7-bis(phenylmethoxy)-8-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 163337716) has the molecular formula C30H32O6 and a molecular weight of 488.58 g/mol. Its IUPAC name is (4aR,6R,7R,8S,8aR)-2-phenyl-6,7-bis(phenylmethoxy)-8-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6R,7R,8S,8aR)-2-phenyl-6,7-bis(phenylmethoxy)-8-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 163337716 |
| Molecular Formula | C30H32O6 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | (4aR,6R,7R,8S,8aR)-2-phenyl-6,7-bis(phenylmethoxy)-8-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | C=CCO[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)O[C@@H]2COC(c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C30H32O6/c1-2-18-31-27-26-25(21-34-29(36-26)24-16-10-5-11-17-24)35-30(33-20-23-14-8-4-9-15-23)28(27)32-19-22-12-6-3-7-13-22/h2-17,25-30H,1,18-21H2/t25-,26-,27+,28-,29?,30-/m1/s1 |
| InChIKey | PNDBQXZBWMHQST-PRUYSOBSSA-N |
| XLogP | 5.20 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|