C31H34O6 — CID 10767783
(2R,4aR,6R,7R,8S,8aR)-6-but-3-en-2-yloxy-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 10767783) has the molecular formula C31H34O6 and a molecular weight of 502.61 g/mol. Its IUPAC name is (2R,4aR,6R,7R,8S,8aR)-6-but-3-en-2-yloxy-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6R,7R,8S,8aR)-6-but-3-en-2-yloxy-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 10767783 |
| Molecular Formula | C31H34O6 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | (2R,4aR,6R,7R,8S,8aR)-6-but-3-en-2-yloxy-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | C=CC(C)O[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H34O6/c1-3-22(2)35-31-29(33-20-24-15-9-5-10-16-24)28(32-19-23-13-7-4-8-14-23)27-26(36-31)21-34-30(37-27)25-17-11-6-12-18-25/h3-18,22,26-31H,1,19-21H2,2H3/t22?,26-,27-,28+,29-,30-,31-/m1/s1 |
| InChIKey | FYLDXYGRYFCDRE-SRTOHLCMSA-N |
| XLogP | 5.59 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|