C28H30O5 — CID 71013745
(6S,8S,8aR)-6-methyl-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 71013745) has the molecular formula C28H30O5 and a molecular weight of 446.54 g/mol. Its IUPAC name is (6S,8S,8aR)-6-methyl-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (6S,8S,8aR)-6-methyl-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 71013745 |
| Molecular Formula | C28H30O5 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (6S,8S,8aR)-6-methyl-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | C[C@@H]1OC2COC(c3ccccc3)O[C@H]2[C@@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C28H30O5/c1-20-25(29-17-21-11-5-2-6-12-21)27(30-18-22-13-7-3-8-14-22)26-24(32-20)19-31-28(33-26)23-15-9-4-10-16-23/h2-16,20,24-28H,17-19H2,1H3/t20-,24?,25?,26+,27-,28?/m0/s1 |
| InChIKey | WNGOGAMGNZXSLV-TWJQUKKESA-N |
| XLogP | 5.06 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |