C21H24O4 — CID 173382281
(8S,8aS)-7-methyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 173382281) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is (8S,8aS)-7-methyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (8S,8aS)-7-methyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 173382281 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (8S,8aS)-7-methyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CC1COC2COC(c3ccccc3)O[C@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H24O4/c1-15-12-22-18-14-24-21(17-10-6-3-7-11-17)25-20(18)19(15)23-13-16-8-4-2-5-9-16/h2-11,15,18-21H,12-14H2,1H3/t15?,18?,19-,20+,21?/m0/s1 |
| InChIKey | VDJHHDJOCFTGKG-CRMGBYGNSA-N |
| XLogP | 3.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |