C22H26O4 — CID 70822984
(6S,8R,8aS)-7,8-dimethyl-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 70822984) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is (6S,8R,8aS)-7,8-dimethyl-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (6S,8R,8aS)-7,8-dimethyl-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 70822984 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (6S,8R,8aS)-7,8-dimethyl-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CC1[C@@H](OCc2ccccc2)OC2COC(c3ccccc3)O[C@H]2[C@@H]1C |
| InChI | InChI=1S/C22H26O4/c1-15-16(2)21(23-13-17-9-5-3-6-10-17)25-19-14-24-22(26-20(15)19)18-11-7-4-8-12-18/h3-12,15-16,19-22H,13-14H2,1-2H3/t15-,16?,19?,20+,21+,22?/m1/s1 |
| InChIKey | MSPTVWDFWIIPKN-VVKTYGLRSA-N |
| XLogP | 4.31 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |