C22H23NO5 — CID 40573607
(1S,2S,6R,7S,9R,12S)-4-methyl-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridec-4-ene (PubChem CID 40573607) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is (1S,2S,6R,7S,9R,12S)-4-methyl-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridec-4-ene.
| Compound Name | (1S,2S,6R,7S,9R,12S)-4-methyl-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridec-4-ene |
|---|---|
| PubChem CID | 40573607 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (1S,2S,6R,7S,9R,12S)-4-methyl-12-phenyl-7-phenylmethoxy-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridec-4-ene |
| SMILES | CC1=N[C@H]2[C@@H](OCc3ccccc3)O[C@@H]3CO[C@H](c4ccccc4)O[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C22H23NO5/c1-14-23-18-20(26-14)19-17(13-25-21(28-19)16-10-6-3-7-11-16)27-22(18)24-12-15-8-4-2-5-9-15/h2-11,17-22H,12-13H2,1H3/t17-,18-,19-,20+,21+,22+/m1/s1 |
| InChIKey | XZEMCDNPNDVLMF-UQOPEDAQSA-N |
| XLogP | 3.23 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |