C23H26O5 — CID 102251540
(1R,3R,5S,7S,8R,9S)-5-methyl-11-phenyl-8-phenylmethoxy-2,6,10,12-tetraoxatricyclo[7.4.0.03,7]tridecane (PubChem CID 102251540) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is (1R,3R,5S,7S,8R,9S)-5-methyl-11-phenyl-8-phenylmethoxy-2,6,10,12-tetraoxatricyclo[7.4.0.03,7]tridecane.
| Compound Name | (1R,3R,5S,7S,8R,9S)-5-methyl-11-phenyl-8-phenylmethoxy-2,6,10,12-tetraoxatricyclo[7.4.0.03,7]tridecane |
|---|---|
| PubChem CID | 102251540 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (1R,3R,5S,7S,8R,9S)-5-methyl-11-phenyl-8-phenylmethoxy-2,6,10,12-tetraoxatricyclo[7.4.0.03,7]tridecane |
| SMILES | C[C@H]1C[C@H]2O[C@@H]3COC(c4ccccc4)O[C@@H]3[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C23H26O5/c1-15-12-18-20(26-15)22(24-13-16-8-4-2-5-9-16)21-19(27-18)14-25-23(28-21)17-10-6-3-7-11-17/h2-11,15,18-23H,12-14H2,1H3/t15-,18+,19+,20-,21-,22+,23?/m0/s1 |
| InChIKey | BLUKZPPQUSVJTD-QTWDZCPXSA-N |
| XLogP | 3.63 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |