C21H24O5 — CID 129388590
(2R,4aR,6S,8S,8aS)-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 129388590) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (2R,4aR,6S,8S,8aS)-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6S,8S,8aS)-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 129388590 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (2R,4aR,6S,8S,8aS)-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CO[C@@H]1C[C@H](OCc2ccccc2)[C@@H]2O[C@H](c3ccccc3)OC[C@H]2O1 |
| InChI | InChI=1S/C21H24O5/c1-22-19-12-17(23-13-15-8-4-2-5-9-15)20-18(25-19)14-24-21(26-20)16-10-6-3-7-11-16/h2-11,17-21H,12-14H2,1H3/t17-,18+,19-,20-,21+/m0/s1 |
| InChIKey | VBKCBFAAWWZUAO-HGJUEJDCSA-N |
| XLogP | 3.45 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |