C20H22O5 — CID 51055828
(4aR,6S,8S,8aS)-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 51055828) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is (4aR,6S,8S,8aS)-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (4aR,6S,8S,8aS)-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 51055828 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (4aR,6S,8S,8aS)-2-phenyl-6-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | O[C@H]1C[C@@H](OCc2ccccc2)O[C@@H]2COC(c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C20H22O5/c21-16-11-18(22-12-14-7-3-1-4-8-14)24-17-13-23-20(25-19(16)17)15-9-5-2-6-10-15/h1-10,16-21H,11-13H2/t16-,17+,18-,19-,20?/m0/s1 |
| InChIKey | BKZQXEWELIKTIZ-SWJQRLJCSA-N |
| XLogP | 2.79 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |