C34H34O6 — CID 101187094
(4aR,6R,7R,8S,8aR)-2-naphthalen-2-yl-7,8-bis(phenylmethoxy)-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 101187094) has the molecular formula C34H34O6 and a molecular weight of 538.64 g/mol. Its IUPAC name is (4aR,6R,7R,8S,8aR)-2-naphthalen-2-yl-7,8-bis(phenylmethoxy)-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6R,7R,8S,8aR)-2-naphthalen-2-yl-7,8-bis(phenylmethoxy)-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 101187094 |
| Molecular Formula | C34H34O6 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | (4aR,6R,7R,8S,8aR)-2-naphthalen-2-yl-7,8-bis(phenylmethoxy)-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | C=CCO[C@@H]1O[C@@H]2COC(c3ccc4ccccc4c3)O[C@H]2[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H34O6/c1-2-19-35-34-32(37-22-25-13-7-4-8-14-25)31(36-21-24-11-5-3-6-12-24)30-29(39-34)23-38-33(40-30)28-18-17-26-15-9-10-16-27(26)20-28/h2-18,20,29-34H,1,19,21-23H2/t29-,30-,31+,32-,33?,34-/m1/s1 |
| InChIKey | OIQBYDILXPTZMW-IOUQCJCSSA-N |
| XLogP | 6.35 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|