C31H30O6 — CID 177405126
(4aR,6S,7R,8S,8aR)-6-methoxy-8-naphthalen-2-yloxy-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 177405126) has the molecular formula C31H30O6 and a molecular weight of 498.58 g/mol. Its IUPAC name is (4aR,6S,7R,8S,8aR)-6-methoxy-8-naphthalen-2-yloxy-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6S,7R,8S,8aR)-6-methoxy-8-naphthalen-2-yloxy-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 177405126 |
| Molecular Formula | C31H30O6 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | (4aR,6S,7R,8S,8aR)-6-methoxy-8-naphthalen-2-yloxy-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](Oc2ccc3ccccc3c2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H30O6/c1-32-31-29(33-19-21-10-4-2-5-11-21)28(35-25-17-16-22-12-8-9-15-24(22)18-25)27-26(36-31)20-34-30(37-27)23-13-6-3-7-14-23/h2-18,26-31H,19-20H2,1H3/t26-,27-,28+,29-,30?,31+/m1/s1 |
| InChIKey | UPVDPXBCNRRECI-HMQNZOLESA-N |
| XLogP | 5.66 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |