C38H36O7 — CID 101187095
(4aR,6S,7R,8S,8aR)-6-(4-methoxyphenoxy)-2-naphthalen-2-yl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 101187095) has the molecular formula C38H36O7 and a molecular weight of 604.70 g/mol. Its IUPAC name is (4aR,6S,7R,8S,8aR)-6-(4-methoxyphenoxy)-2-naphthalen-2-yl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6S,7R,8S,8aR)-6-(4-methoxyphenoxy)-2-naphthalen-2-yl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 101187095 |
| Molecular Formula | C38H36O7 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | (4aR,6S,7R,8S,8aR)-6-(4-methoxyphenoxy)-2-naphthalen-2-yl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | COc1ccc(O[C@@H]2O[C@@H]3COC(c4ccc5ccccc5c4)O[C@H]3[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C38H36O7/c1-39-31-18-20-32(21-19-31)43-38-36(41-24-27-12-6-3-7-13-27)35(40-23-26-10-4-2-5-11-26)34-33(44-38)25-42-37(45-34)30-17-16-28-14-8-9-15-29(28)22-30/h2-22,33-38H,23-25H2,1H3/t33-,34-,35+,36-,37?,38-/m1/s1 |
| InChIKey | WLQFNESOQWKQHG-LWWORWRYSA-N |
| XLogP | 7.24 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |