C28H29O6S- — CID 102191031
(4aR,6R,7R,8S,8aR)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-thiolate (PubChem CID 102191031) has the molecular formula C28H29O6S- and a molecular weight of 493.60 g/mol. Its IUPAC name is (4aR,6R,7R,8S,8aR)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-thiolate.
| Compound Name | (4aR,6R,7R,8S,8aR)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-thiolate |
|---|---|
| PubChem CID | 102191031 |
| Molecular Formula | C28H29O6S- |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | (4aR,6R,7R,8S,8aR)-8-[(4-methoxyphenyl)methoxy]-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-thiolate |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](OCc3ccccc3)[C@@H]([S-])O[C@@H]3COC(c4ccccc4)O[C@@H]23)cc1 |
| InChI | InChI=1S/C28H30O6S/c1-29-22-14-12-20(13-15-22)17-30-25-24-23(18-32-27(34-24)21-10-6-3-7-11-21)33-28(35)26(25)31-16-19-8-4-2-5-9-19/h2-15,23-28,35H,16-18H2,1H3/p-1/t23-,24-,25+,26-,27?,28-/m1/s1 |
| InChIKey | KJJXGTMXBXOUDV-ODBZVETESA-M |
| XLogP | 4.55 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|