C28H29NO8 — CID 134864765
(6S,8aR)-6-methoxy-7-[(4-nitrophenyl)methoxy]-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 134864765) has the molecular formula C28H29NO8 and a molecular weight of 507.54 g/mol. Its IUPAC name is (6S,8aR)-6-methoxy-7-[(4-nitrophenyl)methoxy]-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (6S,8aR)-6-methoxy-7-[(4-nitrophenyl)methoxy]-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 134864765 |
| Molecular Formula | C28H29NO8 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | (6S,8aR)-6-methoxy-7-[(4-nitrophenyl)methoxy]-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CO[C@H]1OC2COC(c3ccccc3)O[C@H]2C(OCc2ccccc2)C1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H29NO8/c1-32-28-26(34-17-20-12-14-22(15-13-20)29(30)31)25(33-16-19-8-4-2-5-9-19)24-23(36-28)18-35-27(37-24)21-10-6-3-7-11-21/h2-15,23-28H,16-18H2,1H3/t23?,24-,25?,26?,27?,28+/m1/s1 |
| InChIKey | JAYQKYMAFCWCCY-UFKOBUODSA-N |
| XLogP | 4.55 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|