C27H27NO10S — CID 57342222
[(2R,4aR,6R,7S,8S,8aR)-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 4-nitrobenzenesulfonate (PubChem CID 57342222) has the molecular formula C27H27NO10S and a molecular weight of 557.58 g/mol. Its IUPAC name is [(2R,4aR,6R,7S,8S,8aR)-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 4-nitrobenzenesulfonate.
| Compound Name | [(2R,4aR,6R,7S,8S,8aR)-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 57342222 |
| Molecular Formula | C27H27NO10S |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | [(2R,4aR,6R,7S,8S,8aR)-6-methoxy-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 4-nitrobenzenesulfonate |
| SMILES | CO[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OCc2ccccc2)[C@@H]1OS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H27NO10S/c1-33-27-25(38-39(31,32)21-14-12-20(13-15-21)28(29)30)24(34-16-18-8-4-2-5-9-18)23-22(36-27)17-35-26(37-23)19-10-6-3-7-11-19/h2-15,22-27H,16-17H2,1H3/t22-,23-,24+,25+,26-,27-/m1/s1 |
| InChIKey | KWOOEFKQJWWZCF-HPRPSTAPSA-N |
| XLogP | 3.74 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|