C22H23F3O8S — CID 10097621
[(2R,4aR,6S,7S,8S,8aR)-6-methoxy-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] trifluoromethanesulfonate (PubChem CID 10097621) has the molecular formula C22H23F3O8S and a molecular weight of 504.48 g/mol. Its IUPAC name is [(2R,4aR,6S,7S,8S,8aR)-6-methoxy-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] trifluoromethanesulfonate.
| Compound Name | [(2R,4aR,6S,7S,8S,8aR)-6-methoxy-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10097621 |
| Molecular Formula | C22H23F3O8S |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | [(2R,4aR,6S,7S,8S,8aR)-6-methoxy-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] trifluoromethanesulfonate |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OS(=O)(=O)C(F)(F)F)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H23F3O8S/c1-28-21-19(29-12-14-8-4-2-5-9-14)18(33-34(26,27)22(23,24)25)17-16(31-21)13-30-20(32-17)15-10-6-3-7-11-15/h2-11,16-21H,12-13H2,1H3/t16-,17-,18+,19+,20-,21+/m1/s1 |
| InChIKey | ISXGSRYCSGKVSF-OUCVULTDSA-N |
| XLogP | 3.29 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|