C20H24O12P2 — CID 10533619
[(4aR,6R,7R,8S,8aS)-2-phenyl-6-phenylmethoxy-7-phosphonooxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] dihydrogen phosphate (PubChem CID 10533619) has the molecular formula C20H24O12P2 and a molecular weight of 518.35 g/mol. Its IUPAC name is [(4aR,6R,7R,8S,8aS)-2-phenyl-6-phenylmethoxy-7-phosphonooxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] dihydrogen phosphate.
| Compound Name | [(4aR,6R,7R,8S,8aS)-2-phenyl-6-phenylmethoxy-7-phosphonooxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10533619 |
| Molecular Formula | C20H24O12P2 |
| Molecular Weight | 518.35 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | [(4aR,6R,7R,8S,8aS)-2-phenyl-6-phenylmethoxy-7-phosphonooxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)O[C@H]1[C@H]2OC(c3ccccc3)OC[C@H]2O[C@@H](OCc2ccccc2)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C20H24O12P2/c21-33(22,23)31-17-16-15(12-28-19(30-16)14-9-5-2-6-10-14)29-20(18(17)32-34(24,25)26)27-11-13-7-3-1-4-8-13/h1-10,15-20H,11-12H2,(H2,21,22,23)(H2,24,25,26)/t15-,16+,17+,18-,19?,20-/m1/s1 |
| InChIKey | HYZNRENASBGRDX-ZGXIQGQBSA-N |
| XLogP | 2.00 |
| TPSA | 170.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|