C36H35NO9 — CID 122579188
[6-[[benzyl(phenylmethoxycarbonyl)amino]methoxy]-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 122579188) has the molecular formula C36H35NO9 and a molecular weight of 625.67 g/mol. Its IUPAC name is [6-[[benzyl(phenylmethoxycarbonyl)amino]methoxy]-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [6-[[benzyl(phenylmethoxycarbonyl)amino]methoxy]-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 122579188 |
| Molecular Formula | C36H35NO9 |
| Molecular Weight | 625.67 g/mol |
| Exact Mass | 625.23 |
| IUPAC Name | [6-[[benzyl(phenylmethoxycarbonyl)amino]methoxy]-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | O=C(OC1C(OCN(Cc2ccccc2)C(=O)OCc2ccccc2)OC2COC(c3ccccc3)OC2C1O)c1ccccc1 |
| InChI | InChI=1S/C36H35NO9/c38-30-31-29(23-41-34(46-31)28-19-11-4-12-20-28)44-35(32(30)45-33(39)27-17-9-3-10-18-27)43-24-37(21-25-13-5-1-6-14-25)36(40)42-22-26-15-7-2-8-16-26/h1-20,29-32,34-35,38H,21-24H2 |
| InChIKey | JACSRCMXFUFPHV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.67 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|