C48H53NO8 — CID 10985588
benzyl N-[6-[[(4aR,6R,7R,8S,8aS)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]hexyl]-N-benzylcarbamate (PubChem CID 10985588) has the molecular formula C48H53NO8 and a molecular weight of 771.95 g/mol. Its IUPAC name is benzyl N-[6-[[(4aR,6R,7R,8S,8aS)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]hexyl]-N-benzylcarbamate.
| Compound Name | benzyl N-[6-[[(4aR,6R,7R,8S,8aS)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]hexyl]-N-benzylcarbamate |
|---|---|
| PubChem CID | 10985588 |
| Molecular Formula | C48H53NO8 |
| Molecular Weight | 771.95 g/mol |
| Exact Mass | 771.38 |
| IUPAC Name | benzyl N-[6-[[(4aR,6R,7R,8S,8aS)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]hexyl]-N-benzylcarbamate |
| SMILES | O=C(OCc1ccccc1)N(CCCCCCO[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@@H]2[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C48H53NO8/c50-48(55-35-40-26-14-6-15-27-40)49(32-37-20-8-3-9-21-37)30-18-1-2-19-31-51-47-45(53-34-39-24-12-5-13-25-39)44(52-33-38-22-10-4-11-23-38)43-42(56-47)36-54-46(57-43)41-28-16-7-17-29-41/h3-17,20-29,42-47H,1-2,18-19,30-36H2/t42-,43+,44+,45-,46?,47-/m1/s1 |
| InChIKey | IQBDUESAQCUUIL-QXIJDSLBSA-N |
| XLogP | 9.41 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.95 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|