C27H46N2O6 — CID 102193452
2-[[(4aR,6R,7R,8S,8aS)-7-(2-aminoethoxy)-6-decoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]ethanamine (PubChem CID 102193452) has the molecular formula C27H46N2O6 and a molecular weight of 494.67 g/mol. Its IUPAC name is 2-[[(4aR,6R,7R,8S,8aS)-7-(2-aminoethoxy)-6-decoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]ethanamine.
| Compound Name | 2-[[(4aR,6R,7R,8S,8aS)-7-(2-aminoethoxy)-6-decoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]ethanamine |
|---|---|
| PubChem CID | 102193452 |
| Molecular Formula | C27H46N2O6 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | 2-[[(4aR,6R,7R,8S,8aS)-7-(2-aminoethoxy)-6-decoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]ethanamine |
| SMILES | CCCCCCCCCCO[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@@H]2[C@H](OCCN)[C@H]1OCCN |
| InChI | InChI=1S/C27H46N2O6/c1-2-3-4-5-6-7-8-12-17-32-27-25(31-19-16-29)24(30-18-15-28)23-22(34-27)20-33-26(35-23)21-13-10-9-11-14-21/h9-11,13-14,22-27H,2-8,12,15-20,28-29H2,1H3/t22-,23+,24+,25-,26?,27-/m1/s1 |
| InChIKey | VVIXGTHDBDSUGP-NJTTWMPNSA-N |
| XLogP | 3.67 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|