C39H66O11 — CID 90287533
(2R,5R,6S)-5-[[(6S,7S,8aS)-7,8-dibutoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-3,4-dibutoxy-6-(butoxymethyl)oxan-2-ol (PubChem CID 90287533) has the molecular formula C39H66O11 and a molecular weight of 710.95 g/mol. Its IUPAC name is (2R,5R,6S)-5-[[(6S,7S,8aS)-7,8-dibutoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-3,4-dibutoxy-6-(butoxymethyl)oxan-2-ol.
| Compound Name | (2R,5R,6S)-5-[[(6S,7S,8aS)-7,8-dibutoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-3,4-dibutoxy-6-(butoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 90287533 |
| Molecular Formula | C39H66O11 |
| Molecular Weight | 710.95 g/mol |
| Exact Mass | 710.46 |
| IUPAC Name | (2R,5R,6S)-5-[[(6S,7S,8aS)-7,8-dibutoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-3,4-dibutoxy-6-(butoxymethyl)oxan-2-ol |
| SMILES | CCCCOC[C@@H]1O[C@@H](O)C(OCCCC)C(OCCCC)[C@@H]1O[C@@H]1OC2COC(c3ccccc3)O[C@@H]2C(OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C39H66O11/c1-6-11-21-41-26-29-31(33(42-22-12-7-2)35(37(40)47-29)44-24-14-9-4)50-39-36(45-25-15-10-5)34(43-23-13-8-3)32-30(48-39)27-46-38(49-32)28-19-17-16-18-20-28/h16-20,29-40H,6-15,21-27H2,1-5H3/t29-,30?,31+,32-,33?,34?,35?,36-,37+,38?,39-/m0/s1 |
| InChIKey | JZHZMZAXXBTUHE-ZPDKEISMSA-N |
| XLogP | 6.49 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.95 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|