C23H32Cl3NO6 — CID 129142274
[(6R,8S,8aS)-7,8-dibutoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 2,2,2-trichloroethanimidate (PubChem CID 129142274) has the molecular formula C23H32Cl3NO6 and a molecular weight of 524.87 g/mol. Its IUPAC name is [(6R,8S,8aS)-7,8-dibutoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(6R,8S,8aS)-7,8-dibutoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 129142274 |
| Molecular Formula | C23H32Cl3NO6 |
| Molecular Weight | 524.87 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | [(6R,8S,8aS)-7,8-dibutoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H]1OC2COC(c3ccccc3)O[C@@H]2[C@H](OCCCC)C1OCCCC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C23H32Cl3NO6/c1-3-5-12-28-18-17-16(14-30-20(32-17)15-10-8-7-9-11-15)31-21(19(18)29-13-6-4-2)33-22(27)23(24,25)26/h7-11,16-21,27H,3-6,12-14H2,1-2H3/b27-22+/t16?,17-,18-,19?,20?,21+/m0/s1 |
| InChIKey | MKOARZRECJWFCH-GGGFHGMESA-N |
| XLogP | 5.56 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.87 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|