C22H20Cl3NO7 — CID 130360659
[(6S,7S,8aS)-8-hydroxy-2-phenyl-6-(2,2,2-trichloroethanimidoyl)oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 130360659) has the molecular formula C22H20Cl3NO7 and a molecular weight of 516.76 g/mol. Its IUPAC name is [(6S,7S,8aS)-8-hydroxy-2-phenyl-6-(2,2,2-trichloroethanimidoyl)oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [(6S,7S,8aS)-8-hydroxy-2-phenyl-6-(2,2,2-trichloroethanimidoyl)oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 130360659 |
| Molecular Formula | C22H20Cl3NO7 |
| Molecular Weight | 516.76 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | [(6S,7S,8aS)-8-hydroxy-2-phenyl-6-(2,2,2-trichloroethanimidoyl)oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | [H]/N=C(/O[C@@H]1OC2COC(c3ccccc3)O[C@H]2C(O)[C@@H]1OC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H20Cl3NO7/c23-22(24,25)21(26)33-20-17(31-18(28)12-7-3-1-4-8-12)15(27)16-14(30-20)11-29-19(32-16)13-9-5-2-6-10-13/h1-10,14-17,19-20,26-27H,11H2/b26-21+/t14?,15?,16-,17+,19?,20+/m1/s1 |
| InChIKey | BPVAUNLIUCTJCP-PYVYYBQESA-N |
| XLogP | 3.78 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.76 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|