C25H24Cl3NO7 — CID 91471795
[(4aR,6R,7R,8S,8aS)-2-phenyl-8-prop-2-enoxy-6-(2,2,2-trichloroethanimidoyl)oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 91471795) has the molecular formula C25H24Cl3NO7 and a molecular weight of 556.83 g/mol. Its IUPAC name is [(4aR,6R,7R,8S,8aS)-2-phenyl-8-prop-2-enoxy-6-(2,2,2-trichloroethanimidoyl)oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [(4aR,6R,7R,8S,8aS)-2-phenyl-8-prop-2-enoxy-6-(2,2,2-trichloroethanimidoyl)oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 91471795 |
| Molecular Formula | C25H24Cl3NO7 |
| Molecular Weight | 556.83 g/mol |
| Exact Mass | 555.06 |
| IUPAC Name | [(4aR,6R,7R,8S,8aS)-2-phenyl-8-prop-2-enoxy-6-(2,2,2-trichloroethanimidoyl)oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | [H]/N=C(/O[C@H]1O[C@@H]2COC(c3ccccc3)O[C@@H]2[C@H](OCC=C)[C@H]1OC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C25H24Cl3NO7/c1-2-13-31-19-18-17(14-32-22(35-18)16-11-7-4-8-12-16)33-23(36-24(29)25(26,27)28)20(19)34-21(30)15-9-5-3-6-10-15/h2-12,17-20,22-23,29H,1,13-14H2/b29-24+/t17-,18+,19+,20-,22?,23-/m1/s1 |
| InChIKey | NRKYTFABZGBWNW-YABMWZGUSA-N |
| XLogP | 4.99 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.83 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|