C25H25ClO8 — CID 10505168
[(4aR,6S,7R,8S,8aR)-8-(2-chloroacetyl)oxy-2-phenyl-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate (PubChem CID 10505168) has the molecular formula C25H25ClO8 and a molecular weight of 488.92 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aR)-8-(2-chloroacetyl)oxy-2-phenyl-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate.
| Compound Name | [(4aR,6S,7R,8S,8aR)-8-(2-chloroacetyl)oxy-2-phenyl-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
|---|---|
| PubChem CID | 10505168 |
| Molecular Formula | C25H25ClO8 |
| Molecular Weight | 488.92 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | [(4aR,6S,7R,8S,8aR)-8-(2-chloroacetyl)oxy-2-phenyl-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] benzoate |
| SMILES | C=CCO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@H](OC(=O)CCl)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H25ClO8/c1-2-13-29-25-22(33-23(28)16-9-5-3-6-10-16)21(32-19(27)14-26)20-18(31-25)15-30-24(34-20)17-11-7-4-8-12-17/h2-12,18,20-22,24-25H,1,13-15H2/t18-,20-,21+,22-,24?,25+/m1/s1 |
| InChIKey | FKKDAASUTQGIOP-PLURGUCBSA-N |
| XLogP | 3.40 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.92 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|