C27H25Cl3N2O9 — CID 139255538
methyl 2-[[(2R,4aR,6S,7R,8R,8aS)-7-(1,3-dioxoisoindol-2-yl)-2-phenyl-6-(2,2,2-trichloroethanimidoyl)oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoate (PubChem CID 139255538) has the molecular formula C27H25Cl3N2O9 and a molecular weight of 627.86 g/mol. Its IUPAC name is methyl 2-[[(2R,4aR,6S,7R,8R,8aS)-7-(1,3-dioxoisoindol-2-yl)-2-phenyl-6-(2,2,2-trichloroethanimidoyl)oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoate.
| Compound Name | methyl 2-[[(2R,4aR,6S,7R,8R,8aS)-7-(1,3-dioxoisoindol-2-yl)-2-phenyl-6-(2,2,2-trichloroethanimidoyl)oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoate |
|---|---|
| PubChem CID | 139255538 |
| Molecular Formula | C27H25Cl3N2O9 |
| Molecular Weight | 627.86 g/mol |
| Exact Mass | 626.06 |
| IUPAC Name | methyl 2-[[(2R,4aR,6S,7R,8R,8aS)-7-(1,3-dioxoisoindol-2-yl)-2-phenyl-6-(2,2,2-trichloroethanimidoyl)oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoate |
| SMILES | [H]/N=C(/O[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](OC(C)C(=O)OC)[C@H]1N1C(=O)c2ccccc2C1=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C27H25Cl3N2O9/c1-13(23(35)36-2)38-20-18(32-21(33)15-10-6-7-11-16(15)22(32)34)25(41-26(31)27(28,29)30)39-17-12-37-24(40-19(17)20)14-8-4-3-5-9-14/h3-11,13,17-20,24-25,31H,12H2,1-2H3/b31-26+/t13?,17-,18-,19-,20-,24-,25+/m1/s1 |
| InChIKey | HNKUFSCKIKQBPX-HZIJLXLOSA-N |
| XLogP | 3.80 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.86 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|