C23H21NO8 — CID 134867179
[(6R,8aS)-7-(1,3-dioxoisoindol-2-yl)-6-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 134867179) has the molecular formula C23H21NO8 and a molecular weight of 439.42 g/mol. Its IUPAC name is [(6R,8aS)-7-(1,3-dioxoisoindol-2-yl)-6-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(6R,8aS)-7-(1,3-dioxoisoindol-2-yl)-6-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 134867179 |
| Molecular Formula | C23H21NO8 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | [(6R,8aS)-7-(1,3-dioxoisoindol-2-yl)-6-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CC(=O)OC1C(N2C(=O)c3ccccc3C2=O)[C@H](O)OC2COC(c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C23H21NO8/c1-12(25)30-19-17(24-20(26)14-9-5-6-10-15(14)21(24)27)22(28)31-16-11-29-23(32-18(16)19)13-7-3-2-4-8-13/h2-10,16-19,22-23,28H,11H2,1H3/t16?,17?,18-,19?,22-,23?/m1/s1 |
| InChIKey | MDPDUQBDLVROFB-CAOALPAISA-N |
| XLogP | 1.41 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|