C21H22O6Se — CID 11037714
[(2R,4aR,6S,7R,8R,8aR)-7-hydroxy-2-phenyl-6-phenylselanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (PubChem CID 11037714) has the molecular formula C21H22O6Se and a molecular weight of 449.36 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8R,8aR)-7-hydroxy-2-phenyl-6-phenylselanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate.
| Compound Name | [(2R,4aR,6S,7R,8R,8aR)-7-hydroxy-2-phenyl-6-phenylselanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
|---|---|
| PubChem CID | 11037714 |
| Molecular Formula | C21H22O6Se |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | [(2R,4aR,6S,7R,8R,8aR)-7-hydroxy-2-phenyl-6-phenylselanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)[C@H]([Se]c2ccccc2)O[C@@H]2CO[C@@H](c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C21H22O6Se/c1-13(22)25-19-17(23)21(28-15-10-6-3-7-11-15)26-16-12-24-20(27-18(16)19)14-8-4-2-5-9-14/h2-11,16-21,23H,12H2,1H3/t16-,17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | BLHMKGLPDGTTJC-UFOPBENGSA-N |
| XLogP | 1.15 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|