C22H24O6S — CID 177468118
[(2R,4aR,6R,7S,8S,8aS)-8-hydroxy-6-(4-methylphenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate (PubChem CID 177468118) has the molecular formula C22H24O6S and a molecular weight of 416.50 g/mol. Its IUPAC name is [(2R,4aR,6R,7S,8S,8aS)-8-hydroxy-6-(4-methylphenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate.
| Compound Name | [(2R,4aR,6R,7S,8S,8aS)-8-hydroxy-6-(4-methylphenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
|---|---|
| PubChem CID | 177468118 |
| Molecular Formula | C22H24O6S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | [(2R,4aR,6R,7S,8S,8aS)-8-hydroxy-6-(4-methylphenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](O)[C@@H]2O[C@H](c3ccccc3)OC[C@H]2O[C@@H]1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C22H24O6S/c1-13-8-10-16(11-9-13)29-22-20(26-14(2)23)18(24)19-17(27-22)12-25-21(28-19)15-6-4-3-5-7-15/h3-11,17-22,24H,12H2,1-2H3/t17-,18+,19-,20+,21-,22-/m1/s1 |
| InChIKey | UHHVYABJYWTBDA-RKYRPXKFSA-N |
| XLogP | 3.22 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |