C21H22O6S — CID 11338605
[(2R,4aR,6S,7R,8S,8aS)-8-hydroxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate (PubChem CID 11338605) has the molecular formula C21H22O6S and a molecular weight of 402.47 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8S,8aS)-8-hydroxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate.
| Compound Name | [(2R,4aR,6S,7R,8S,8aS)-8-hydroxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
|---|---|
| PubChem CID | 11338605 |
| Molecular Formula | C21H22O6S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | [(2R,4aR,6S,7R,8S,8aS)-8-hydroxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O)[C@@H]2O[C@H](c3ccccc3)OC[C@H]2O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C21H22O6S/c1-13(22)25-19-17(23)18-16(26-21(19)28-15-10-6-3-7-11-15)12-24-20(27-18)14-8-4-2-5-9-14/h2-11,16-21,23H,12H2,1H3/t16-,17+,18-,19-,20-,21+/m1/s1 |
| InChIKey | GWTONIWBPILHGT-RLLAOZKESA-N |
| XLogP | 2.91 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |